C33H35N2O4S+ — CID 101250428
(R)-[(1S,2R,4S,5R)-1-[[4-(benzenesulfonyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 101250428) has the molecular formula C33H35N2O4S+ and a molecular weight of 555.72 g/mol. Its IUPAC name is (R)-[(1S,2R,4S,5R)-1-[[4-(benzenesulfonyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(1S,2R,4S,5R)-1-[[4-(benzenesulfonyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 101250428 |
| Molecular Formula | C33H35N2O4S+ |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (R)-[(1S,2R,4S,5R)-1-[[4-(benzenesulfonyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3ccc(S(=O)(=O)c4ccccc4)cc3)CC[C@H]1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C33H35N2O4S/c1-3-24-22-35(21-23-9-12-28(13-10-23)40(37,38)27-7-5-4-6-8-27)18-16-25(24)19-32(35)33(36)29-15-17-34-31-14-11-26(39-2)20-30(29)31/h3-15,17,20,24-25,32-33,36H,1,16,18-19,21-22H2,2H3/q+1/t24-,25-,32+,33+,35+/m0/s1 |
| InChIKey | ZLOVMISTPNEQNY-FFLLKLSISA-N |
| XLogP | 5.72 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|