C33H32N3O+ — CID 11135529
(R)-[(2S,4S,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 11135529) has the molecular formula C33H32N3O+ and a molecular weight of 486.64 g/mol. Its IUPAC name is (R)-[(2S,4S,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (R)-[(2S,4S,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 11135529 |
| Molecular Formula | C33H32N3O+ |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (R)-[(2S,4S,5R)-1-(acridin-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3c4ccccc4nc4ccccc34)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C33H32N3O/c1-2-22-20-36(21-28-25-10-4-7-13-30(25)35-31-14-8-5-11-26(28)31)18-16-23(22)19-32(36)33(37)27-15-17-34-29-12-6-3-9-24(27)29/h2-15,17,22-23,32-33,37H,1,16,18-21H2/q+1/t22-,23-,32-,33+,36?/m0/s1 |
| InChIKey | KKRUTGMUKVZWSO-SASLWKNWSA-N |
| XLogP | 6.58 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|