C27H26F5N2O2+ — CID 118906865
(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 118906865) has the molecular formula C27H26F5N2O2+ and a molecular weight of 505.51 g/mol. Its IUPAC name is (R)-[(1S,2S,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(1S,2S,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 118906865 |
| Molecular Formula | C27H26F5N2O2+ |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (R)-[(1S,2S,4S,5R)-5-ethenyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3c(F)c(F)c(F)c(F)c3F)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C27H26F5N2O2/c1-3-14-12-34(13-19-22(28)24(30)26(32)25(31)23(19)29)9-7-15(14)10-21(34)27(35)17-6-8-33-20-5-4-16(36-2)11-18(17)20/h3-6,8,11,14-15,21,27,35H,1,7,9-10,12-13H2,2H3/q+1/t14-,15-,21-,27+,34-/m0/s1 |
| InChIKey | XXALOTDWKKSDOG-RSGLWNNMSA-N |
| XLogP | 5.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|