C25H43NO — CID 142241706
(1R,2R,4S)-2,5-dimethyl-4-propyl-1-quinolin-4-ylheptan-1-ol;ethane (PubChem CID 142241706) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is (1R,2R,4S)-2,5-dimethyl-4-propyl-1-quinolin-4-ylheptan-1-ol;ethane.
| Compound Name | (1R,2R,4S)-2,5-dimethyl-4-propyl-1-quinolin-4-ylheptan-1-ol;ethane |
|---|---|
| PubChem CID | 142241706 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (1R,2R,4S)-2,5-dimethyl-4-propyl-1-quinolin-4-ylheptan-1-ol;ethane |
| SMILES | CC.CC.CCC[C@@H](C[C@@H](C)[C@@H](O)c1ccnc2ccccc12)C(C)CC |
| InChI | InChI=1S/C21H31NO.2C2H6/c1-5-9-17(15(3)6-2)14-16(4)21(23)19-12-13-22-20-11-8-7-10-18(19)20;2*1-2/h7-8,10-13,15-17,21,23H,5-6,9,14H2,1-4H3;2*1-2H3/t15?,16-,17+,21-;;/m1../s1 |
| InChIKey | DACBVGKACALAES-NOPWREFBSA-N |
| XLogP | 7.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |