C12H14N2O2 — CID 66206365
2-amino-1-quinolin-4-ylpropane-1,3-diol (PubChem CID 66206365) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-amino-1-quinolin-4-ylpropane-1,3-diol.
| Compound Name | 2-amino-1-quinolin-4-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 66206365 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-amino-1-quinolin-4-ylpropane-1,3-diol |
| SMILES | NC(CO)C(O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C12H14N2O2/c13-10(7-15)12(16)9-5-6-14-11-4-2-1-3-8(9)11/h1-6,10,12,15-16H,7,13H2 |
| InChIKey | IQYBEPIETOTFPA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |