C27H34N2O13 — CID 3053308
bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one (PubChem CID 3053308) has the molecular formula C27H34N2O13 and a molecular weight of 594.57 g/mol. Its IUPAC name is bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one.
| Compound Name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 3053308 |
| Molecular Formula | C27H34N2O13 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one |
| SMILES | C=C[C@H]1CNCC[C@H]1CCC(=O)c1ccnc2ccccc12.O=C(O)[C@H](O)[C@@H](O)C(=O)O.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C19H22N2O.2C4H6O6/c1-2-14-13-20-11-9-15(14)7-8-19(22)17-10-12-21-18-6-4-3-5-16(17)18;2*5-1(3(7)8)2(6)4(9)10/h2-6,10,12,14-15,20H,1,7-9,11,13H2;2*1-2,5-6H,(H,7,8)(H,9,10)/t14-,15+;2*1-,2-/m011/s1 |
| InChIKey | PLBSOEQCDDZPLY-WYEJUUCOSA-N |
| XLogP | -0.64 |
| TPSA | 272.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|