C26H34N2O7 — CID 71480821
2,3-dihydroxybutanedioic acid;3-(3-ethenyl-1-propylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-one (PubChem CID 71480821) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;3-(3-ethenyl-1-propylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-one.
| Compound Name | 2,3-dihydroxybutanedioic acid;3-(3-ethenyl-1-propylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 71480821 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;3-(3-ethenyl-1-propylpiperidin-4-yl)-1-quinolin-4-ylpropan-1-one |
| SMILES | C=CC1CN(CCC)CCC1CCC(=O)c1ccnc2ccccc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C22H28N2O.C4H6O6/c1-3-14-24-15-12-18(17(4-2)16-24)9-10-22(25)20-11-13-23-21-8-6-5-7-19(20)21;5-1(3(7)8)2(6)4(9)10/h4-8,11,13,17-18H,2-3,9-10,12,14-16H2,1H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | KTBAJIKXQNEDKX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|