C24H30N2O — CID 71480656
2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one (PubChem CID 71480656) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one.
| Compound Name | 2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71480656 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one |
| SMILES | C=CC1CN(CC(C)C)CCC1CC(=C)C(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C24H30N2O/c1-5-19-16-26(15-17(2)3)13-11-20(19)14-18(4)24(27)22-10-12-25-23-9-7-6-8-21(22)23/h5-10,12,17,19-20H,1,4,11,13-16H2,2-3H3 |
| InChIKey | OWRDKEXGJYIJMP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|