C28H39N3O7 — CID 71480924
2,3-dihydroxybutanedioic acid;3-[1-[3-(dimethylamino)propyl]-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one (PubChem CID 71480924) has the molecular formula C28H39N3O7 and a molecular weight of 529.63 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;3-[1-[3-(dimethylamino)propyl]-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one.
| Compound Name | 2,3-dihydroxybutanedioic acid;3-[1-[3-(dimethylamino)propyl]-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 71480924 |
| Molecular Formula | C28H39N3O7 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;3-[1-[3-(dimethylamino)propyl]-3-ethenylpiperidin-4-yl]-1-quinolin-4-ylpropan-1-one |
| SMILES | C=CC1CN(CCCN(C)C)CCC1CCC(=O)c1ccnc2ccccc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C24H33N3O.C4H6O6/c1-4-19-18-27(16-7-15-26(2)3)17-13-20(19)10-11-24(28)22-12-14-25-23-9-6-5-8-21(22)23;5-1(3(7)8)2(6)4(9)10/h4-6,8-9,12,14,19-20H,1,7,10-11,13,15-18H2,2-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | YNVRBOQEYNRDDB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|