C28H36N2O7 — CID 71481010
2,3-dihydroxybutanedioic acid;2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one (PubChem CID 71481010) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71481010 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-[[3-ethenyl-1-(2-methylpropyl)piperidin-4-yl]methyl]-1-quinolin-4-ylprop-2-en-1-one |
| SMILES | C=CC1CN(CC(C)C)CCC1CC(=C)C(=O)c1ccnc2ccccc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C24H30N2O.C4H6O6/c1-5-19-16-26(15-17(2)3)13-11-20(19)14-18(4)24(27)22-10-12-25-23-9-7-6-8-21(22)23;5-1(3(7)8)2(6)4(9)10/h5-10,12,17,19-20H,1,4,11,13-16H2,2-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | DSVQYNLIPWLCHA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|