C23H28N2O2 — CID 11890273
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] butanoate (PubChem CID 11890273) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] butanoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] butanoate |
|---|---|
| PubChem CID | 11890273 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] butanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)CCC)c1ccnc2ccccc12 |
| InChI | InChI=1S/C23H28N2O2/c1-3-7-22(26)27-23(19-10-12-24-20-9-6-5-8-18(19)20)21-14-17-11-13-25(21)15-16(17)4-2/h4-6,8-10,12,16-17,21,23H,2-3,7,11,13-15H2,1H3/t16-,17-,21-,23+/m0/s1 |
| InChIKey | OHNDQUSNRRCMEC-SJQULFJYSA-N |
| XLogP | 4.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|