C26H25ClN2O2 — CID 5018597
[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] 4-chlorobenzoate (PubChem CID 5018597) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] 4-chlorobenzoate.
| Compound Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 5018597 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] 4-chlorobenzoate |
| SMILES | C=CC1CN2CCC1CC2C(OC(=O)c1ccc(Cl)cc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H25ClN2O2/c1-2-17-16-29-14-12-19(17)15-24(29)25(31-26(30)18-7-9-20(27)10-8-18)22-11-13-28-23-6-4-3-5-21(22)23/h2-11,13,17,19,24-25H,1,12,14-16H2 |
| InChIKey | GHCHPKUPRWVVTJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|