C27H28N2O4 — CID 143765540
[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-hydroxybenzoate (PubChem CID 143765540) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-hydroxybenzoate.
| Compound Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 143765540 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-hydroxybenzoate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](OC(=O)c1ccc(O)cc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C27H28N2O4/c1-3-17-16-29-13-11-19(17)14-25(29)26(33-27(31)18-4-6-20(30)7-5-18)22-10-12-28-24-9-8-21(32-2)15-23(22)24/h3-10,12,15,17,19,25-26,30H,1,11,13-14,16H2,2H3/t17-,19?,25-,26+/m0/s1 |
| InChIKey | BIJAMTLHQIVARW-ZTOHDJCNSA-N |
| XLogP | 4.74 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|