C20H23N2O4P — CID 18654380
CID 18654380 (PubChem CID 18654380) has the molecular formula C20H23N2O4P and a molecular weight of 386.39 g/mol.
| Compound Name | CID 18654380 |
|---|---|
| PubChem CID | 18654380 |
| Molecular Formula | C20H23N2O4P |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | — |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OP(=O)=O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H23N2O4P/c1-3-13-12-22-9-7-14(13)10-19(22)20(26-27(23)24)16-6-8-21-18-5-4-15(25-2)11-17(16)18/h3-6,8,11,13-14,19-20H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | PBVDMYOAJCFUMK-WZBLMQSHSA-N |
| XLogP | 4.29 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|