C26H27ClN2O2 — CID 54312801
4-[(R)-(4-chlorophenoxy)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline (PubChem CID 54312801) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 4-[(R)-(4-chlorophenoxy)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline.
| Compound Name | 4-[(R)-(4-chlorophenoxy)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 54312801 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[(R)-(4-chlorophenoxy)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](Oc1ccc(Cl)cc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H27ClN2O2/c1-3-17-16-29-13-11-18(17)14-25(29)26(31-20-6-4-19(27)5-7-20)22-10-12-28-24-9-8-21(30-2)15-23(22)24/h3-10,12,15,17-18,25-26H,1,11,13-14,16H2,2H3/t17-,18-,25-,26+/m0/s1 |
| InChIKey | SMBWQWPVIZMVDI-NKSQBKDSSA-N |
| XLogP | 5.91 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|