C20H25N3O4S — CID 165359439
[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] sulfamate (PubChem CID 165359439) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] sulfamate.
| Compound Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] sulfamate |
|---|---|
| PubChem CID | 165359439 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] sulfamate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](OS(N)(=O)=O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H25N3O4S/c1-3-13-12-23-9-7-14(13)10-19(23)20(27-28(21,24)25)16-6-8-22-18-5-4-15(26-2)11-17(16)18/h3-6,8,11,13-14,19-20H,1,7,9-10,12H2,2H3,(H2,21,24,25)/t13-,14?,19-,20+/m0/s1 |
| InChIKey | QDXOANPXVYAVFB-VOMFEXJBSA-N |
| XLogP | 2.40 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|