C25H34N2O3S — CID 59658494
CID 59658494 (PubChem CID 59658494) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol.
| Compound Name | CID 59658494 |
|---|---|
| PubChem CID | 59658494 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | — |
| SMILES | [CH]S(O)(O[C@H](c1ccnc2ccc(OC)cc12)C1CC2CCN1CC2C=C)C(C)(C)C |
| InChI | InChI=1S/C25H34N2O3S/c1-7-17-16-27-13-11-18(17)14-23(27)24(30-31(6,28)25(2,3)4)20-10-12-26-22-9-8-19(29-5)15-21(20)22/h6-10,12,15,17-18,23-24,28H,1,11,13-14,16H2,2-5H3/t17?,18?,23?,24-/m1/s1 |
| InChIKey | XVOOUPKHBASSAA-NVTLTSMNSA-N |
| XLogP | 5.86 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|