C28H30N2O3 — CID 3305764
[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 2-methylbenzoate (PubChem CID 3305764) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 2-methylbenzoate.
| Compound Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 3305764 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 2-methylbenzoate |
| SMILES | C=CC1CN2CCC1CC2C(OC(=O)c1ccccc1C)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H30N2O3/c1-4-19-17-30-14-12-20(19)15-26(30)27(33-28(31)22-8-6-5-7-18(22)2)23-11-13-29-25-10-9-21(32-3)16-24(23)25/h4-11,13,16,19-20,26-27H,1,12,14-15,17H2,2-3H3 |
| InChIKey | OJNMPADCGDQKKW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|