C28H31ClN2O4 — CID 44784046
[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate;hydrochloride (PubChem CID 44784046) has the molecular formula C28H31ClN2O4 and a molecular weight of 495.02 g/mol. Its IUPAC name is [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate;hydrochloride.
| Compound Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 44784046 |
| Molecular Formula | C28H31ClN2O4 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate;hydrochloride |
| SMILES | C=CC1CN2CCC1CC2C(OC(=O)c1ccc(OC)cc1)c1ccnc2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C28H30N2O4.ClH/c1-4-18-17-30-14-12-20(18)15-26(30)27(34-28(31)19-5-7-21(32-2)8-6-19)23-11-13-29-25-10-9-22(33-3)16-24(23)25;/h4-11,13,16,18,20,26-27H,1,12,14-15,17H2,2-3H3;1H |
| InChIKey | UDXCCUVVRLWFCH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|