C43H52N2O4 — CID 21020469
[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-(4-decoxyphenyl)benzoate (PubChem CID 21020469) has the molecular formula C43H52N2O4 and a molecular weight of 660.90 g/mol. Its IUPAC name is [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-(4-decoxyphenyl)benzoate.
| Compound Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-(4-decoxyphenyl)benzoate |
|---|---|
| PubChem CID | 21020469 |
| Molecular Formula | C43H52N2O4 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] 4-(4-decoxyphenyl)benzoate |
| SMILES | C=CC1CN2CCC1CC2C(OC(=O)c1ccc(-c2ccc(OCCCCCCCCCC)cc2)cc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C43H52N2O4/c1-4-6-7-8-9-10-11-12-27-48-36-19-17-33(18-20-36)32-13-15-34(16-14-32)43(46)49-42(41-28-35-24-26-45(41)30-31(35)5-2)38-23-25-44-40-22-21-37(47-3)29-39(38)40/h5,13-23,25,29,31,35,41-42H,2,4,6-12,24,26-28,30H2,1,3H3 |
| InChIKey | KLYTZFPOXVDURG-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|