C26H35N3O3 — CID 164672445
[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 164672445) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is [(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | [(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 164672445 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | [(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl] (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | C=CC1CN2CCC1CC2[C@H](OC(=O)[C@@H](N)C(C)(C)C)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H35N3O3/c1-6-16-15-29-12-10-17(16)13-22(29)23(32-25(30)24(27)26(2,3)4)19-9-11-28-21-8-7-18(31-5)14-20(19)21/h6-9,11,14,16-17,22-24H,1,10,12-13,15,27H2,2-5H3/t16?,17?,22?,23-,24-/m1/s1 |
| InChIKey | YVUNSVPFUHDEKD-LYBYVYCDSA-N |
| XLogP | 4.10 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|