C25H32N2O3 — CID 91082491
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-methylbutanoate (PubChem CID 91082491) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-methylbutanoate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 91082491 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-methylbutanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)C(C)CC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H32N2O3/c1-5-16(3)25(28)30-24(23-13-18-10-12-27(23)15-17(18)6-2)20-9-11-26-22-8-7-19(29-4)14-21(20)22/h6-9,11,14,16-18,23-24H,2,5,10,12-13,15H2,1,3-4H3/t16?,17-,18-,23+,24-/m0/s1 |
| InChIKey | MXFSHYJEDNXOGC-WCCZPAENSA-N |
| XLogP | 4.77 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|