C25H33N3O3 — CID 101354812
[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate (PubChem CID 101354812) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is [(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate.
| Compound Name | [(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 101354812 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | [(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](OC(=O)NC(C)(C)C)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H33N3O3/c1-6-16-15-28-12-10-17(16)13-22(28)23(31-24(29)27-25(2,3)4)19-9-11-26-21-8-7-18(30-5)14-20(19)21/h6-9,11,14,16-17,22-23H,1,10,12-13,15H2,2-5H3,(H,27,29)/t16-,17-,22-,23-/m0/s1 |
| InChIKey | IPPWGLLZPBKGPB-DODAUVCRSA-N |
| XLogP | 4.71 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|