C24H29N3O5 — CID 67163146
3-[[(R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]propanoic acid (PubChem CID 67163146) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[[(R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]propanoic acid.
| Compound Name | 3-[[(R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67163146 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[[(R)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]propanoic acid |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@H](OC(=O)NCCC(=O)O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H29N3O5/c1-3-15-14-27-11-8-16(15)12-21(27)23(32-24(30)26-10-7-22(28)29)18-6-9-25-20-5-4-17(31-2)13-19(18)20/h3-6,9,13,15-16,21,23H,1,7-8,10-12,14H2,2H3,(H,26,30)(H,28,29)/t15?,16?,21-,23+/m0/s1 |
| InChIKey | SZVMPNSYDZTALM-YAZQHSKLSA-N |
| XLogP | 3.38 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|