C31H39N3O3 — CID 101063010
[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(1-adamantyl)carbamate (PubChem CID 101063010) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(1-adamantyl)carbamate.
| Compound Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 101063010 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(1-adamantyl)carbamate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](OC(=O)NC12CC3CC(CC(C3)C1)C2)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C31H39N3O3/c1-3-22-18-34-9-7-23(22)13-28(34)29(25-6-8-32-27-5-4-24(36-2)14-26(25)27)37-30(35)33-31-15-19-10-20(16-31)12-21(11-19)17-31/h3-6,8,14,19-23,28-29H,1,7,9-13,15-18H2,2H3,(H,33,35)/t19?,20?,21?,22-,23?,28-,29+,31?/m0/s1 |
| InChIKey | JHWSIXNMFIPZRP-BKSGWLEESA-N |
| XLogP | 5.88 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|