C31H40N2O2 — CID 102135799
4-[(S)-1-adamantylmethoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline (PubChem CID 102135799) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is 4-[(S)-1-adamantylmethoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline.
| Compound Name | 4-[(S)-1-adamantylmethoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 102135799 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 4-[(S)-1-adamantylmethoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OCC12CC3CC(CC(C3)C1)C2)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C31H40N2O2/c1-3-23-18-33-9-7-24(23)13-29(33)30(26-6-8-32-28-5-4-25(34-2)14-27(26)28)35-19-31-15-20-10-21(16-31)12-22(11-20)17-31/h3-6,8,14,20-24,29-30H,1,7,9-13,15-19H2,2H3/t20?,21?,22?,23-,24-,29+,30-,31?/m0/s1 |
| InChIKey | OESAFKNJVKBBKD-YLBTYDRESA-N |
| XLogP | 6.41 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|