C25H31N3O5 — CID 67754691
ethyl 2-[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]acetate (PubChem CID 67754691) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 2-[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]acetate.
| Compound Name | ethyl 2-[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]acetate |
|---|---|
| PubChem CID | 67754691 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | ethyl 2-[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]carbonylamino]acetate |
| SMILES | C=CC1CN2CCC1CC2[C@@H](OC(=O)NCC(=O)OCC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H31N3O5/c1-4-16-15-28-11-9-17(16)12-22(28)24(33-25(30)27-14-23(29)32-5-2)19-8-10-26-21-7-6-18(31-3)13-20(19)21/h4,6-8,10,13,16-17,22,24H,1,5,9,11-12,14-15H2,2-3H3,(H,27,30)/t16?,17?,22?,24-/m0/s1 |
| InChIKey | DBCDCFRXUFZIQM-AXNWUPBJSA-N |
| XLogP | 3.47 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|