C26H37N2O5P — CID 10051182
[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] dipropyl phosphate (PubChem CID 10051182) has the molecular formula C26H37N2O5P and a molecular weight of 488.57 g/mol. Its IUPAC name is [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] dipropyl phosphate.
| Compound Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] dipropyl phosphate |
|---|---|
| PubChem CID | 10051182 |
| Molecular Formula | C26H37N2O5P |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] dipropyl phosphate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](OP(=O)(OCCC)OCCC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H37N2O5P/c1-5-14-31-34(29,32-15-6-2)33-26(25-16-20-11-13-28(25)18-19(20)7-3)22-10-12-27-24-9-8-21(30-4)17-23(22)24/h7-10,12,17,19-20,25-26H,3,5-6,11,13-16,18H2,1-2,4H3/t19-,20?,25-,26+/m0/s1 |
| InChIKey | GLDMTFUJFQHOCB-PBXIXSDQSA-N |
| XLogP | 6.16 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|