C20H24N2O3S — CID 10981578
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] methanesulfonate (PubChem CID 10981578) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] methanesulfonate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] methanesulfonate |
|---|---|
| PubChem CID | 10981578 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] methanesulfonate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OS(C)(=O)=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H24N2O3S/c1-3-14-13-22-11-9-15(14)12-19(22)20(25-26(2,23)24)17-8-10-21-18-7-5-4-6-16(17)18/h3-8,10,14-15,19-20H,1,9,11-13H2,2H3/t14-,15-,19-,20+/m0/s1 |
| InChIKey | DIHLQPTVCUZBHX-HZVDNRATSA-N |
| XLogP | 3.15 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|