C40H42N2OSi — CID 102177046
tribenzyl-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]silane (PubChem CID 102177046) has the molecular formula C40H42N2OSi and a molecular weight of 594.88 g/mol. Its IUPAC name is tribenzyl-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]silane.
| Compound Name | tribenzyl-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]silane |
|---|---|
| PubChem CID | 102177046 |
| Molecular Formula | C40H42N2OSi |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | tribenzyl-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]silane |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O[Si](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C40H42N2OSi/c1-2-34-27-42-25-23-35(34)26-39(42)40(37-22-24-41-38-21-13-12-20-36(37)38)43-44(28-31-14-6-3-7-15-31,29-32-16-8-4-9-17-32)30-33-18-10-5-11-19-33/h2-22,24,34-35,39-40H,1,23,25-30H2/t34-,35-,39-,40+/m0/s1 |
| InChIKey | DWXLVXSTRVCOHH-FIYJPXHISA-N |
| XLogP | 8.48 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|