C24H24N2O2S — CID 11895344
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2-carboxylate (PubChem CID 11895344) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2-carboxylate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 11895344 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2-carboxylate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)c1cccs1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C24H24N2O2S/c1-2-16-15-26-12-10-17(16)14-21(26)23(28-24(27)22-8-5-13-29-22)19-9-11-25-20-7-4-3-6-18(19)20/h2-9,11,13,16-17,21,23H,1,10,12,14-15H2/t16-,17-,21+,23-/m0/s1 |
| InChIKey | AUNGOGZQBOMHHB-GZSQKZNCSA-N |
| XLogP | 5.09 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|