C17H21ClN2O — CID 24843603
3-piperidin-3-yl-1-quinolin-4-ylpropan-1-one;hydrochloride (PubChem CID 24843603) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-piperidin-3-yl-1-quinolin-4-ylpropan-1-one;hydrochloride.
| Compound Name | 3-piperidin-3-yl-1-quinolin-4-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 24843603 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-piperidin-3-yl-1-quinolin-4-ylpropan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCC1CCCNC1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C17H20N2O.ClH/c20-17(8-7-13-4-3-10-18-12-13)15-9-11-19-16-6-2-1-5-14(15)16;/h1-2,5-6,9,11,13,18H,3-4,7-8,10,12H2;1H |
| InChIKey | NOYMDILEDJOEGV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |