C28H30N2O3 — CID 70102404
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]phenyl]prop-2-ynyl (3R)-piperidine-3-carboxylate (PubChem CID 70102404) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]phenyl]prop-2-ynyl (3R)-piperidine-3-carboxylate.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]phenyl]prop-2-ynyl (3R)-piperidine-3-carboxylate |
|---|---|
| PubChem CID | 70102404 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]phenyl]prop-2-ynyl (3R)-piperidine-3-carboxylate |
| SMILES | COc1ccc2nccc(CCCc3ccc(C#CCOC(=O)[C@@H]4CCCNC4)cc3)c2c1 |
| InChI | InChI=1S/C28H30N2O3/c1-32-25-13-14-27-26(19-25)23(15-17-30-27)7-2-5-21-9-11-22(12-10-21)6-4-18-33-28(31)24-8-3-16-29-20-24/h9-15,17,19,24,29H,2-3,5,7-8,16,18,20H2,1H3/t24-/m1/s1 |
| InChIKey | BWYBQMVHGSVWII-XMMPIXPASA-N |
| XLogP | 4.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|