C26H35N3O — CID 142884526
N-[(6-methoxyquinolin-4-yl)methyl]azepan-4-amine;propylbenzene (PubChem CID 142884526) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(6-methoxyquinolin-4-yl)methyl]azepan-4-amine;propylbenzene.
| Compound Name | N-[(6-methoxyquinolin-4-yl)methyl]azepan-4-amine;propylbenzene |
|---|---|
| PubChem CID | 142884526 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-[(6-methoxyquinolin-4-yl)methyl]azepan-4-amine;propylbenzene |
| SMILES | CCCc1ccccc1.COc1ccc2nccc(CNC3CCCNCC3)c2c1 |
| InChI | InChI=1S/C17H23N3O.C9H12/c1-21-15-4-5-17-16(11-15)13(6-10-19-17)12-20-14-3-2-8-18-9-7-14;1-2-6-9-7-4-3-5-8-9/h4-6,10-11,14,18,20H,2-3,7-9,12H2,1H3;3-5,7-8H,2,6H2,1H3 |
| InChIKey | WFXCKWKEAOOZOY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |