C15H20ClN3O — CID 163407511
4-(4-phenylmethoxypyrazol-1-yl)piperidine;hydrochloride (PubChem CID 163407511) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 4-(4-phenylmethoxypyrazol-1-yl)piperidine;hydrochloride.
| Compound Name | 4-(4-phenylmethoxypyrazol-1-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 163407511 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-(4-phenylmethoxypyrazol-1-yl)piperidine;hydrochloride |
| SMILES | Cl.c1ccc(COc2cnn(C3CCNCC3)c2)cc1 |
| InChI | InChI=1S/C15H19N3O.ClH/c1-2-4-13(5-3-1)12-19-15-10-17-18(11-15)14-6-8-16-9-7-14;/h1-5,10-11,14,16H,6-9,12H2;1H |
| InChIKey | GIHIFBOTBVQDMN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |