C19H16Cl2F2N6O2 — CID 167290873
5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 167290873) has the molecular formula C19H16Cl2F2N6O2 and a molecular weight of 469.28 g/mol. Its IUPAC name is 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 167290873 |
| Molecular Formula | C19H16Cl2F2N6O2 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | [H]/N=C(\c1cnc(N)c(OC(F)F)c1)c1cc(O[C@H](N)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C19H16Cl2F2N6O2/c20-11-6-28-7-12(21)15(11)18(27)30-9-1-2-13(24)10(4-9)16(25)8-3-14(31-19(22)23)17(26)29-5-8/h1-7,18-19,25H,24,27H2,(H2,26,29)/b25-16+/t18-/m0/s1 |
| InChIKey | KJCUBXQAJGGQMH-LEBHPONQSA-N |
| XLogP | 4.00 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|