C18H14Cl3N5O — CID 170708740
2-(6-chloropyridazine-3-carboximidoyl)-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline (PubChem CID 170708740) has the molecular formula C18H14Cl3N5O and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-(6-chloropyridazine-3-carboximidoyl)-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline.
| Compound Name | 2-(6-chloropyridazine-3-carboximidoyl)-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
|---|---|
| PubChem CID | 170708740 |
| Molecular Formula | C18H14Cl3N5O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 2-(6-chloropyridazine-3-carboximidoyl)-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
| SMILES | [H]/N=C(\c1ccc(Cl)nn1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C18H14Cl3N5O/c1-9(17-12(19)7-24-8-13(17)20)27-10-2-3-14(22)11(6-10)18(23)15-4-5-16(21)26-25-15/h2-9,23H,22H2,1H3/b23-18-/t9-/m1/s1 |
| InChIKey | AXIHCCLWINDHJS-KNZBJDSLSA-N |
| XLogP | 4.97 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|