C15H13Cl2N3O2 — CID 126481518
2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-2-iminoacetaldehyde (PubChem CID 126481518) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-2-iminoacetaldehyde.
| Compound Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-2-iminoacetaldehyde |
|---|---|
| PubChem CID | 126481518 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-2-iminoacetaldehyde |
| SMILES | [H]/N=C(\C=O)c1cc(OC(C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C15H13Cl2N3O2/c1-8(15-11(16)5-20-6-12(15)17)22-9-2-3-13(18)10(4-9)14(19)7-21/h2-8,19H,18H2,1H3/b19-14+ |
| InChIKey | PAUWCPJKTIEGQK-XMHGGMMESA-N |
| XLogP | 3.68 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|