C23H25Cl2N7O — CID 177139694
2-[3-(1,6-diazaspiro[3.3]heptan-6-yl)-1,6-dihydropyridazine-6-carboximidoyl]-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline (PubChem CID 177139694) has the molecular formula C23H25Cl2N7O and a molecular weight of 486.41 g/mol. Its IUPAC name is 2-[3-(1,6-diazaspiro[3.3]heptan-6-yl)-1,6-dihydropyridazine-6-carboximidoyl]-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline.
| Compound Name | 2-[3-(1,6-diazaspiro[3.3]heptan-6-yl)-1,6-dihydropyridazine-6-carboximidoyl]-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
|---|---|
| PubChem CID | 177139694 |
| Molecular Formula | C23H25Cl2N7O |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[3-(1,6-diazaspiro[3.3]heptan-6-yl)-1,6-dihydropyridazine-6-carboximidoyl]-4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
| SMILES | [H]/N=C(/c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N)C1C=CC(N2CC3(CCN3)C2)=NN1 |
| InChI | InChI=1S/C23H25Cl2N7O/c1-13(21-16(24)9-28-10-17(21)25)33-14-2-3-18(26)15(8-14)22(27)19-4-5-20(31-30-19)32-11-23(12-32)6-7-29-23/h2-5,8-10,13,19,27,29-30H,6-7,11-12,26H2,1H3/b27-22-/t13-,19?/m1/s1 |
| InChIKey | NEHKDVKOSZOPLR-KVEBPQGHSA-N |
| XLogP | 3.37 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|