C27H31Cl3N4O — CID 145231322
2-[(E)-2-[[(3E,5E)-5-chloro-3-methylhepta-1,3,5-trien-4-yl]amino]-3-methylpent-2-enimidoyl]-4-[1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline (PubChem CID 145231322) has the molecular formula C27H31Cl3N4O and a molecular weight of 533.93 g/mol. Its IUPAC name is 2-[(E)-2-[[(3E,5E)-5-chloro-3-methylhepta-1,3,5-trien-4-yl]amino]-3-methylpent-2-enimidoyl]-4-[1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline.
| Compound Name | 2-[(E)-2-[[(3E,5E)-5-chloro-3-methylhepta-1,3,5-trien-4-yl]amino]-3-methylpent-2-enimidoyl]-4-[1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
|---|---|
| PubChem CID | 145231322 |
| Molecular Formula | C27H31Cl3N4O |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[(E)-2-[[(3E,5E)-5-chloro-3-methylhepta-1,3,5-trien-4-yl]amino]-3-methylpent-2-enimidoyl]-4-[1-(3,5-dichloro-4-pyridinyl)ethoxy]aniline |
| SMILES | [H]/N=C(C(\NC(/C(Cl)=C\C)=C(\C)C=C)=C(\C)CC)/c1cc(OC(C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C27H31Cl3N4O/c1-7-15(4)26(20(28)9-3)34-27(16(5)8-2)25(32)19-12-18(10-11-23(19)31)35-17(6)24-21(29)13-33-14-22(24)30/h7,9-14,17,32,34H,1,8,31H2,2-6H3/b20-9+,26-15+,27-16+,32-25- |
| InChIKey | KVQRNXIFTFLITJ-XPOYUCQNSA-N |
| XLogP | 8.35 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|