C16H17Cl2N3O2 — CID 164565649
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-ethanimidoyl-5-methoxyaniline (PubChem CID 164565649) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-ethanimidoyl-5-methoxyaniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-ethanimidoyl-5-methoxyaniline |
|---|---|
| PubChem CID | 164565649 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-ethanimidoyl-5-methoxyaniline |
| SMILES | [H]/N=C(\C)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)c(OC)cc1N |
| InChI | InChI=1S/C16H17Cl2N3O2/c1-8(19)10-4-15(14(22-3)5-13(10)20)23-9(2)16-11(17)6-21-7-12(16)18/h4-7,9,19H,20H2,1-3H3/b19-8+/t9-/m1/s1 |
| InChIKey | DPAQLRRTEMBZBH-HURAESQDSA-N |
| XLogP | 4.51 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|