C20H19Cl2IN5OP — CID 156804577
5-[5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridin-2-amine (PubChem CID 156804577) has the molecular formula C20H19Cl2IN5OP and a molecular weight of 574.19 g/mol. Its IUPAC name is 5-[5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridin-2-amine.
| Compound Name | 5-[5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridin-2-amine |
|---|---|
| PubChem CID | 156804577 |
| Molecular Formula | C20H19Cl2IN5OP |
| Molecular Weight | 574.19 g/mol |
| Exact Mass | 572.97 |
| IUPAC Name | 5-[5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridin-2-amine |
| SMILES | [H]/N=C(\c1ccc(N)nc1)c1cc(O[C@H](C)c2c(Cl)cnc(C)c2Cl)ccc1NPI |
| InChI | InChI=1S/C20H19Cl2IN5OP/c1-10-19(22)18(15(21)9-26-10)11(2)29-13-4-5-16(28-30-23)14(7-13)20(25)12-3-6-17(24)27-8-12/h3-9,11,25,28,30H,1-2H3,(H2,24,27)/b25-20+/t11-/m1/s1 |
| InChIKey | LCEHGTVJIPDVPQ-XTFYIUDMSA-N |
| XLogP | 6.59 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.19 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|