C20H16Cl2IN4O3P — CID 171820603
methyl 5-[5-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridine-2-carboxylate (PubChem CID 171820603) has the molecular formula C20H16Cl2IN4O3P and a molecular weight of 589.16 g/mol. Its IUPAC name is methyl 5-[5-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[5-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171820603 |
| Molecular Formula | C20H16Cl2IN4O3P |
| Molecular Weight | 589.16 g/mol |
| Exact Mass | 587.94 |
| IUPAC Name | methyl 5-[5-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]pyridine-2-carboxylate |
| SMILES | [H]/N=C(\c1ccc(C(=O)OC)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1NPI |
| InChI | InChI=1S/C20H16Cl2IN4O3P/c1-29-20(28)18-4-2-11(7-26-18)19(24)13-6-12(3-5-17(13)27-31-23)30-10-14-15(21)8-25-9-16(14)22/h2-9,24,27,31H,10H2,1H3/b24-19+ |
| InChIKey | MDHALSNQDWPODL-LYBHJNIJSA-N |
| XLogP | 5.92 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.16 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|