C20H14Cl2FIN5OP — CID 170708961
5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]-2-fluoropyridine-3-carbonitrile (PubChem CID 170708961) has the molecular formula C20H14Cl2FIN5OP and a molecular weight of 588.15 g/mol. Its IUPAC name is 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]-2-fluoropyridine-3-carbonitrile.
| Compound Name | 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]-2-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170708961 |
| Molecular Formula | C20H14Cl2FIN5OP |
| Molecular Weight | 588.15 g/mol |
| Exact Mass | 586.93 |
| IUPAC Name | 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(iodophosphanylamino)benzenecarboximidoyl]-2-fluoropyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(F)c(C#N)c1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1NPI |
| InChI | InChI=1S/C20H14Cl2FIN5OP/c1-10(18-15(21)8-27-9-16(18)22)30-13-2-3-17(29-31-24)14(5-13)19(26)12-4-11(6-25)20(23)28-7-12/h2-5,7-10,26,29,31H,1H3/b26-19+/t10-/m1/s1 |
| InChIKey | XOTLFYAPQLPUDQ-RKASEQLSSA-N |
| XLogP | 6.71 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.15 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|