C21H27N7O — CID 144795352
4-[2-[3-[(methylideneamino)-[(Z)-prop-1-enyl]amino]azetidin-1-yl]pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine (PubChem CID 144795352) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 4-[2-[3-[(methylideneamino)-[(Z)-prop-1-enyl]amino]azetidin-1-yl]pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine.
| Compound Name | 4-[2-[3-[(methylideneamino)-[(Z)-prop-1-enyl]amino]azetidin-1-yl]pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
|---|---|
| PubChem CID | 144795352 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-[2-[3-[(methylideneamino)-[(Z)-prop-1-enyl]amino]azetidin-1-yl]pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
| SMILES | [H]/N=C(\c1ccnc(N2CC(N(/C=C\C)N=C)C2)c1)c1cc(OC(C)C)ncc1N |
| InChI | InChI=1S/C21H27N7O/c1-5-8-28(24-4)16-12-27(13-16)19-9-15(6-7-25-19)21(23)17-10-20(29-14(2)3)26-11-18(17)22/h5-11,14,16,23H,4,12-13,22H2,1-3H3/b8-5-,23-21+ |
| InChIKey | SXJJNKAJAMPSAK-OOWXNYEHSA-N |
| XLogP | 2.90 |
| TPSA | 103.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|