C20H32N6O — CID 144694407
2-[3-(4-ethylpiperazin-1-yl)-1-methylpyrazole-5-carboximidoyl]-4-propan-2-yloxyaniline;molecular hydrogen (PubChem CID 144694407) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[3-(4-ethylpiperazin-1-yl)-1-methylpyrazole-5-carboximidoyl]-4-propan-2-yloxyaniline;molecular hydrogen.
| Compound Name | 2-[3-(4-ethylpiperazin-1-yl)-1-methylpyrazole-5-carboximidoyl]-4-propan-2-yloxyaniline;molecular hydrogen |
|---|---|
| PubChem CID | 144694407 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-[3-(4-ethylpiperazin-1-yl)-1-methylpyrazole-5-carboximidoyl]-4-propan-2-yloxyaniline;molecular hydrogen |
| SMILES | [H]/N=C(/c1cc(OC(C)C)ccc1N)c1cc(N2CCN(CC)CC2)nn1C.[H][H] |
| InChI | InChI=1S/C20H30N6O.H2/c1-5-25-8-10-26(11-9-25)19-13-18(24(4)23-19)20(22)16-12-15(27-14(2)3)6-7-17(16)21;/h6-7,12-14,22H,5,8-11,21H2,1-4H3;1H/b22-20-; |
| InChIKey | KXYNVBZFGYTIOC-KGYDJYTLSA-N |
| XLogP | 2.59 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|