C21H28N8O — CID 144694758
5-[4-amino-3-(1-methyl-3-morpholin-4-ylpyrazole-5-carboximidoyl)phenyl]-2-imino-N-methylpyridin-1-amine;molecular hydrogen (PubChem CID 144694758) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is 5-[4-amino-3-(1-methyl-3-morpholin-4-ylpyrazole-5-carboximidoyl)phenyl]-2-imino-N-methylpyridin-1-amine;molecular hydrogen.
| Compound Name | 5-[4-amino-3-(1-methyl-3-morpholin-4-ylpyrazole-5-carboximidoyl)phenyl]-2-imino-N-methylpyridin-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 144694758 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 5-[4-amino-3-(1-methyl-3-morpholin-4-ylpyrazole-5-carboximidoyl)phenyl]-2-imino-N-methylpyridin-1-amine;molecular hydrogen |
| SMILES | [H]/N=C(/c1cc(-c2cc/c(=N\[H])n(NC)c2)ccc1N)c1cc(N2CCOCC2)nn1C.[H][H] |
| InChI | InChI=1S/C21H26N8O.H2/c1-25-29-13-15(4-6-19(29)23)14-3-5-17(22)16(11-14)21(24)18-12-20(26-27(18)2)28-7-9-30-10-8-28;/h3-6,11-13,23-25H,7-10,22H2,1-2H3;1H/b23-19+,24-21-; |
| InChIKey | UDYVCHDOTDDCPC-KLQSTIQASA-N |
| XLogP | 1.62 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|