C19H27N5O2 — CID 144694418
4-ethoxy-2-[1-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrazole-3-carboximidoyl]aniline;molecular hydrogen (PubChem CID 144694418) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-ethoxy-2-[1-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrazole-3-carboximidoyl]aniline;molecular hydrogen.
| Compound Name | 4-ethoxy-2-[1-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrazole-3-carboximidoyl]aniline;molecular hydrogen |
|---|---|
| PubChem CID | 144694418 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 4-ethoxy-2-[1-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrazole-3-carboximidoyl]aniline;molecular hydrogen |
| SMILES | [H]/N=C(\c1cc(N2CC3CCC(C2)O3)n(C)n1)c1cc(OCC)ccc1N.[H][H] |
| InChI | InChI=1S/C19H25N5O2.H2/c1-3-25-12-6-7-16(20)15(8-12)19(21)17-9-18(23(2)22-17)24-10-13-4-5-14(11-24)26-13;/h6-9,13-14,21H,3-5,10-11,20H2,1-2H3;1H/b21-19-; |
| InChIKey | AGGMARLWQZLZMB-WQGAEACMSA-N |
| XLogP | 2.43 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|