C20H29N5O3 — CID 144694591
2-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-methylpyrazole-3-carboximidoyl]-4-(2-methoxyethoxy)aniline (PubChem CID 144694591) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-methylpyrazole-3-carboximidoyl]-4-(2-methoxyethoxy)aniline.
| Compound Name | 2-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-methylpyrazole-3-carboximidoyl]-4-(2-methoxyethoxy)aniline |
|---|---|
| PubChem CID | 144694591 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-methylpyrazole-3-carboximidoyl]-4-(2-methoxyethoxy)aniline |
| SMILES | [H]/N=C(\c1cc(N2C[C@@H](C)O[C@@H](C)C2)n(C)n1)c1cc(OCCOC)ccc1N |
| InChI | InChI=1S/C20H29N5O3/c1-13-11-25(12-14(2)28-13)19-10-18(23-24(19)3)20(22)16-9-15(5-6-17(16)21)27-8-7-26-4/h5-6,9-10,13-14,22H,7-8,11-12,21H2,1-4H3/b22-20-/t13-,14+ |
| InChIKey | OUZXBAAEHKAPJD-HHOSYTOVSA-N |
| XLogP | 2.06 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|