C26H31N5O — CID 145005747
1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]benzimidazol-1-yl]methyl]azepan-1-yl]-3-phenylpropan-1-one (PubChem CID 145005747) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]benzimidazol-1-yl]methyl]azepan-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]benzimidazol-1-yl]methyl]azepan-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 145005747 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]benzimidazol-1-yl]methyl]azepan-1-yl]-3-phenylpropan-1-one |
| SMILES | [H]/N=C/C(=C\N)c1ccc2c(c1)ncn2CC1CCCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N5O/c27-16-23(17-28)22-9-10-25-24(15-22)29-19-31(25)18-21-7-4-13-30(14-12-21)26(32)11-8-20-5-2-1-3-6-20/h1-3,5-6,9-10,15-17,19,21,27H,4,7-8,11-14,18,28H2/b23-17+,27-16+ |
| InChIKey | KWRBDARMUOIHKZ-AZAHODGUSA-N |
| XLogP | 4.25 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|